CAS No: 480438-75-3, Chemical Name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
the physical and chemical property of 480438-75-3, tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate is provided by ChemNet.com
ChemNet > CAS > 480438-75-3 tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
480438-75-3 tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
| اسم المنتج |
tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate |
| الاسم المستعار |
Carbonic acid, 1,1-dimethylethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl ester; tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate; 4-hydroxy-2-nitrobenzoic acid |
| الصيغة الجزيئية |
C7H5NO5 |
| الوزن الجزيئي الغرامي |
183.1183 |
| InChI |
InChI=1/C7H5NO5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H,(H,10,11) |
| إستراتيجية المساعدة القطرية |
480438-75-3 |
| بنية جزيئية |
|
| كثافة |
1.631g/cm3 |
| نقطة الغليان |
414°C at 760 mmHg |
| معامل الإنكسار |
1.663 |
| نقطة الوميض |
190.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
